C15H12Cl4N2O3 — CID 2726166
3,5-dichloro-N'-(2,5-dichlorophenyl)-2,6-dimethoxybenzohydrazide (PubChem CID 2726166) has the molecular formula C15H12Cl4N2O3 and a molecular weight of 410.08 g/mol. Its IUPAC name is 3,5-dichloro-N'-(2,5-dichlorophenyl)-2,6-dimethoxybenzohydrazide.
| Compound Name | 3,5-dichloro-N'-(2,5-dichlorophenyl)-2,6-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 2726166 |
| Molecular Formula | C15H12Cl4N2O3 |
| Molecular Weight | 410.08 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | 3,5-dichloro-N'-(2,5-dichlorophenyl)-2,6-dimethoxybenzohydrazide |
| SMILES | COc1c(Cl)cc(Cl)c(OC)c1C(=O)NNc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H12Cl4N2O3/c1-23-13-9(18)6-10(19)14(24-2)12(13)15(22)21-20-11-5-7(16)3-4-8(11)17/h3-6,20H,1-2H3,(H,21,22) |
| InChIKey | IDNAKSQHSCHGOU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.08 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|