C20H14Cl4N2O2 — CID 5140750
2,2-bis(4-chlorophenyl)-N'-(2,5-dichlorophenyl)-2-hydroxyacetohydrazide (PubChem CID 5140750) has the molecular formula C20H14Cl4N2O2 and a molecular weight of 456.16 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)-N'-(2,5-dichlorophenyl)-2-hydroxyacetohydrazide.
| Compound Name | 2,2-bis(4-chlorophenyl)-N'-(2,5-dichlorophenyl)-2-hydroxyacetohydrazide |
|---|---|
| PubChem CID | 5140750 |
| Molecular Formula | C20H14Cl4N2O2 |
| Molecular Weight | 456.16 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)-N'-(2,5-dichlorophenyl)-2-hydroxyacetohydrazide |
| SMILES | O=C(NNc1cc(Cl)ccc1Cl)C(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14Cl4N2O2/c21-14-5-1-12(2-6-14)20(28,13-3-7-15(22)8-4-13)19(27)26-25-18-11-16(23)9-10-17(18)24/h1-11,25,28H,(H,26,27) |
| InChIKey | FLXBCLRJCOEBSQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.16 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|