C18H26N3OS+ — CID 2730127
N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine (PubChem CID 2730127) has the molecular formula C18H26N3OS+ and a molecular weight of 332.49 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine.
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 2730127 |
| Molecular Formula | C18H26N3OS+ |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)phenyl]-3-ethyl-4-methyl-1,3-thiazol-3-ium-2-amine |
| SMILES | CC[n+]1c(C)csc1Nc1ccc(N2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C18H25N3OS/c1-5-21-13(2)12-23-18(21)19-16-6-8-17(9-7-16)20-10-14(3)22-15(4)11-20/h6-9,12,14-15H,5,10-11H2,1-4H3/p+1 |
| InChIKey | KTLNWZQHGPTYBE-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 28.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|