C17H22N4O5 — CID 2731845
ethyl 5-methyl-3-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-1H-pyrazole-4-carboxylate (PubChem CID 2731845) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is ethyl 5-methyl-3-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-methyl-3-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2731845 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | ethyl 5-methyl-3-[2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(NN=Cc2cc(OC)c(OC)c(OC)c2)n[nH]c1C |
| InChI | InChI=1S/C17H22N4O5/c1-6-26-17(22)14-10(2)19-21-16(14)20-18-9-11-7-12(23-3)15(25-5)13(8-11)24-4/h7-9H,6H2,1-5H3,(H2,19,20,21) |
| InChIKey | KRWVRGBWFIJLQM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|