C14H17N3O6S2 — CID 2738735
methyl 1-methyl-5-[(4-sulfamoylphenyl)methylsulfamoyl]pyrrole-2-carboxylate (PubChem CID 2738735) has the molecular formula C14H17N3O6S2 and a molecular weight of 387.44 g/mol. Its IUPAC name is methyl 1-methyl-5-[(4-sulfamoylphenyl)methylsulfamoyl]pyrrole-2-carboxylate.
| Compound Name | methyl 1-methyl-5-[(4-sulfamoylphenyl)methylsulfamoyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 2738735 |
| Molecular Formula | C14H17N3O6S2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | methyl 1-methyl-5-[(4-sulfamoylphenyl)methylsulfamoyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCc2ccc(S(N)(=O)=O)cc2)n1C |
| InChI | InChI=1S/C14H17N3O6S2/c1-17-12(14(18)23-2)7-8-13(17)25(21,22)16-9-10-3-5-11(6-4-10)24(15,19)20/h3-8,16H,9H2,1-2H3,(H2,15,19,20) |
| InChIKey | XSOAUKSLMOYZBR-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 137.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |