C20H21N3O7S — CID 2742737
3-(tert-butylsulfonylmethyl)-5-[2-(4-methoxyphenoxy)-5-nitrophenyl]-1,2,4-oxadiazole (PubChem CID 2742737) has the molecular formula C20H21N3O7S and a molecular weight of 447.47 g/mol. Its IUPAC name is 3-(tert-butylsulfonylmethyl)-5-[2-(4-methoxyphenoxy)-5-nitrophenyl]-1,2,4-oxadiazole.
| Compound Name | 3-(tert-butylsulfonylmethyl)-5-[2-(4-methoxyphenoxy)-5-nitrophenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2742737 |
| Molecular Formula | C20H21N3O7S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 3-(tert-butylsulfonylmethyl)-5-[2-(4-methoxyphenoxy)-5-nitrophenyl]-1,2,4-oxadiazole |
| SMILES | COc1ccc(Oc2ccc([N+](=O)[O-])cc2-c2nc(CS(=O)(=O)C(C)(C)C)no2)cc1 |
| InChI | InChI=1S/C20H21N3O7S/c1-20(2,3)31(26,27)12-18-21-19(30-22-18)16-11-13(23(24)25)5-10-17(16)29-15-8-6-14(28-4)7-9-15/h5-11H,12H2,1-4H3 |
| InChIKey | BLQMYRPDDKETEL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 134.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|