C17H15BrCl2FNO3 — CID 27447242
N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-2,4-dichloro-5-fluorobenzamide (PubChem CID 27447242) has the molecular formula C17H15BrCl2FNO3 and a molecular weight of 451.12 g/mol. Its IUPAC name is N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-2,4-dichloro-5-fluorobenzamide.
| Compound Name | N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-2,4-dichloro-5-fluorobenzamide |
|---|---|
| PubChem CID | 27447242 |
| Molecular Formula | C17H15BrCl2FNO3 |
| Molecular Weight | 451.12 g/mol |
| Exact Mass | 448.96 |
| IUPAC Name | N-[2-(2-bromo-4,5-dimethoxyphenyl)ethyl]-2,4-dichloro-5-fluorobenzamide |
| SMILES | COc1cc(Br)c(CCNC(=O)c2cc(F)c(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C17H15BrCl2FNO3/c1-24-15-5-9(11(18)7-16(15)25-2)3-4-22-17(23)10-6-14(21)13(20)8-12(10)19/h5-8H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | RCUWZDCFLACJGQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.12 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|