About 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate
4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate (PubChem CID 2754724) has the molecular formula C12H18N2O2S5
and a molecular weight of 382.62 g/mol. Its IUPAC name is 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate.
Molecular Properties
| Compound Name | 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate |
| PubChem CID | 2754724 |
| Molecular Formula | C12H18N2O2S5 |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate |
| SMILES | CSC(=NS(=O)(=O)c1ccc(N)cc1)SC.CSC(C)=S |
| InChI | InChI=1S/C9H12N2O2S3.C3H6S2/c1-14-9(15-2)11-16(12,13)8-5-3-7(10)4-6-8;1-3(4)5-2/h3-6H,10H2,1-2H3;1-2H3 |
| InChIKey | XMDKZFYQNFVLCZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate?
The IUPAC name of 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate (CID 2754724) is 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate.
What is the SMILES notation for 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate?
The canonical SMILES for 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate is CSC(=NS(=O)(=O)c1ccc(N)cc1)SC.CSC(C)=S.
What is the InChIKey of 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate?
The InChIKey is XMDKZFYQNFVLCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S3.C3H6S2/c1-14-9(15-2)11-16(12,13)8-5-3-7(10)4-6-8;1-3(4)5-2/h3-6H,10H2,1-2H3;1-2H3.
What are the key properties of 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate?
4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate has a molecular weight of 382.62 g/mol, XLogP of 3.74, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[bis(methylsulfanyl)methylidene]benzenesulfonamide;methyl ethanedithioate is sourced from PubChem (CID 2754724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).