C10H13N3O3S — CID 168720535
N'-(4-aminophenyl)sulfonyl-3-hydroxybut-2-enimidamide (PubChem CID 168720535) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is N'-(4-aminophenyl)sulfonyl-3-hydroxybut-2-enimidamide.
| Compound Name | N'-(4-aminophenyl)sulfonyl-3-hydroxybut-2-enimidamide |
|---|---|
| PubChem CID | 168720535 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N'-(4-aminophenyl)sulfonyl-3-hydroxybut-2-enimidamide |
| SMILES | CC(O)=CC(N)=NS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C10H13N3O3S/c1-7(14)6-10(12)13-17(15,16)9-4-2-8(11)3-5-9/h2-6,14H,11H2,1H3,(H2,12,13) |
| InChIKey | CQSREULPHOUSFX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|