C14H14N3NaO5S2 — CID 74084511
sodium N-[5-amino-2-(4-aminophenyl)sulfonylphenyl]sulfonylethanimidate (PubChem CID 74084511) has the molecular formula C14H14N3NaO5S2 and a molecular weight of 391.41 g/mol. Its IUPAC name is sodium N-[5-amino-2-(4-aminophenyl)sulfonylphenyl]sulfonylethanimidate.
| Compound Name | sodium N-[5-amino-2-(4-aminophenyl)sulfonylphenyl]sulfonylethanimidate |
|---|---|
| PubChem CID | 74084511 |
| Molecular Formula | C14H14N3NaO5S2 |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | sodium N-[5-amino-2-(4-aminophenyl)sulfonylphenyl]sulfonylethanimidate |
| SMILES | CC([O-])=NS(=O)(=O)c1cc(N)ccc1S(=O)(=O)c1ccc(N)cc1.[Na+] |
| InChI | InChI=1S/C14H15N3O5S2.Na/c1-9(18)17-24(21,22)14-8-11(16)4-7-13(14)23(19,20)12-5-2-10(15)3-6-12;/h2-8H,15-16H2,1H3,(H,17,18);/q;+1/p-1 |
| InChIKey | PVGBHEUCHKGFQP-UHFFFAOYSA-M |
| XLogP | -2.84 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|