C17H14Cl2N2O3S — CID 2766411
1-(benzenesulfonyl)-5-[1-(2,4-dichlorophenoxy)ethyl]pyrazole (PubChem CID 2766411) has the molecular formula C17H14Cl2N2O3S and a molecular weight of 397.28 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-[1-(2,4-dichlorophenoxy)ethyl]pyrazole.
| Compound Name | 1-(benzenesulfonyl)-5-[1-(2,4-dichlorophenoxy)ethyl]pyrazole |
|---|---|
| PubChem CID | 2766411 |
| Molecular Formula | C17H14Cl2N2O3S |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 1-(benzenesulfonyl)-5-[1-(2,4-dichlorophenoxy)ethyl]pyrazole |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)c1ccnn1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H14Cl2N2O3S/c1-12(24-17-8-7-13(18)11-15(17)19)16-9-10-20-21(16)25(22,23)14-5-3-2-4-6-14/h2-12H,1H3 |
| InChIKey | HEJFANYCHUZBEM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |