C19H20N4O5 — CID 2777837
2,4-dinitro-N-[1-(3-phenyloxiran-2-yl)pentylideneamino]aniline (PubChem CID 2777837) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is 2,4-dinitro-N-[1-(3-phenyloxiran-2-yl)pentylideneamino]aniline.
| Compound Name | 2,4-dinitro-N-[1-(3-phenyloxiran-2-yl)pentylideneamino]aniline |
|---|---|
| PubChem CID | 2777837 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2,4-dinitro-N-[1-(3-phenyloxiran-2-yl)pentylideneamino]aniline |
| SMILES | CCCCC(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C1OC1c1ccccc1 |
| InChI | InChI=1S/C19H20N4O5/c1-2-3-9-16(19-18(28-19)13-7-5-4-6-8-13)21-20-15-11-10-14(22(24)25)12-17(15)23(26)27/h4-8,10-12,18-20H,2-3,9H2,1H3 |
| InChIKey | NCQXLXKULSCVPF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 123.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|