C22H21NO5S — CID 2786680
(5-acetyl-2,3-dimethyl-6-oxo-1-phenyl-4-pyridinyl) 4-methylbenzenesulfonate (PubChem CID 2786680) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is (5-acetyl-2,3-dimethyl-6-oxo-1-phenyl-4-pyridinyl) 4-methylbenzenesulfonate.
| Compound Name | (5-acetyl-2,3-dimethyl-6-oxo-1-phenyl-4-pyridinyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2786680 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (5-acetyl-2,3-dimethyl-6-oxo-1-phenyl-4-pyridinyl) 4-methylbenzenesulfonate |
| SMILES | CC(=O)c1c(OS(=O)(=O)c2ccc(C)cc2)c(C)c(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C22H21NO5S/c1-14-10-12-19(13-11-14)29(26,27)28-21-15(2)16(3)23(18-8-6-5-7-9-18)22(25)20(21)17(4)24/h5-13H,1-4H3 |
| InChIKey | VLQWTVBSXQGVAS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|