C20H12Cl3N3S2 — CID 2796831
1-(1,3-benzothiazol-2-yl)-1-(3-chlorophenyl)-3-(2,4-dichlorophenyl)thiourea (PubChem CID 2796831) has the molecular formula C20H12Cl3N3S2 and a molecular weight of 464.83 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-1-(3-chlorophenyl)-3-(2,4-dichlorophenyl)thiourea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-1-(3-chlorophenyl)-3-(2,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 2796831 |
| Molecular Formula | C20H12Cl3N3S2 |
| Molecular Weight | 464.83 g/mol |
| Exact Mass | 462.95 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-1-(3-chlorophenyl)-3-(2,4-dichlorophenyl)thiourea |
| SMILES | S=C(Nc1ccc(Cl)cc1Cl)N(c1cccc(Cl)c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H12Cl3N3S2/c21-12-4-3-5-14(10-12)26(20-25-17-6-1-2-7-18(17)28-20)19(27)24-16-9-8-13(22)11-15(16)23/h1-11H,(H,24,27) |
| InChIKey | FIXNJKQUJNGCMS-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.83 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|