C19H12Cl2N2O3 — CID 2800043
[4-(cyanomethyl)phenyl] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 2800043) has the molecular formula C19H12Cl2N2O3 and a molecular weight of 387.22 g/mol. Its IUPAC name is [4-(cyanomethyl)phenyl] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | [4-(cyanomethyl)phenyl] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 2800043 |
| Molecular Formula | C19H12Cl2N2O3 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | [4-(cyanomethyl)phenyl] 3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)Oc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C19H12Cl2N2O3/c1-11-16(18(23-26-11)17-14(20)3-2-4-15(17)21)19(24)25-13-7-5-12(6-8-13)9-10-22/h2-8H,9H2,1H3 |
| InChIKey | DFFDHNKVLYLKFV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 76.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|