C17H12ClFN2O4S — CID 2810152
2-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)-4-fluorobenzamide (PubChem CID 2810152) has the molecular formula C17H12ClFN2O4S and a molecular weight of 394.81 g/mol. Its IUPAC name is 2-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)-4-fluorobenzamide.
| Compound Name | 2-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 2810152 |
| Molecular Formula | C17H12ClFN2O4S |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 2-chloro-N-(6,7-dimethoxy-4-oxo-3,1-benzothiazin-2-yl)-4-fluorobenzamide |
| SMILES | COc1cc2nc(NC(=O)c3ccc(F)cc3Cl)sc(=O)c2cc1OC |
| InChI | InChI=1S/C17H12ClFN2O4S/c1-24-13-6-10-12(7-14(13)25-2)20-17(26-16(10)23)21-15(22)9-4-3-8(19)5-11(9)18/h3-7H,1-2H3,(H,20,21,22) |
| InChIKey | VDYZKZUXNOXOHG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |