C19H29BrN4O2S — CID 2824031
6-[(4-nitrophenyl)methylsulfanyl]-3-(3,3,5-trimethylcyclohexyl)-2,4-dihydro-1H-1,3,5-triazine;hydrobromide (PubChem CID 2824031) has the molecular formula C19H29BrN4O2S and a molecular weight of 457.44 g/mol. Its IUPAC name is 6-[(4-nitrophenyl)methylsulfanyl]-3-(3,3,5-trimethylcyclohexyl)-2,4-dihydro-1H-1,3,5-triazine;hydrobromide.
| Compound Name | 6-[(4-nitrophenyl)methylsulfanyl]-3-(3,3,5-trimethylcyclohexyl)-2,4-dihydro-1H-1,3,5-triazine;hydrobromide |
|---|---|
| PubChem CID | 2824031 |
| Molecular Formula | C19H29BrN4O2S |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 6-[(4-nitrophenyl)methylsulfanyl]-3-(3,3,5-trimethylcyclohexyl)-2,4-dihydro-1H-1,3,5-triazine;hydrobromide |
| SMILES | Br.CC1CC(N2CN=C(SCc3ccc([N+](=O)[O-])cc3)NC2)CC(C)(C)C1 |
| InChI | InChI=1S/C19H28N4O2S.BrH/c1-14-8-17(10-19(2,3)9-14)22-12-20-18(21-13-22)26-11-15-4-6-16(7-5-15)23(24)25;/h4-7,14,17H,8-13H2,1-3H3,(H,20,21);1H |
| InChIKey | WNVHCIGVUILHNU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|