C23H24BrN3O4S — CID 2846970
butyl 5-acetyloxy-6-bromo-2-(carbamimidoylsulfanylmethyl)-1-phenylindole-3-carboxylate (PubChem CID 2846970) has the molecular formula C23H24BrN3O4S and a molecular weight of 518.43 g/mol. Its IUPAC name is butyl 5-acetyloxy-6-bromo-2-(carbamimidoylsulfanylmethyl)-1-phenylindole-3-carboxylate.
| Compound Name | butyl 5-acetyloxy-6-bromo-2-(carbamimidoylsulfanylmethyl)-1-phenylindole-3-carboxylate |
|---|---|
| PubChem CID | 2846970 |
| Molecular Formula | C23H24BrN3O4S |
| Molecular Weight | 518.43 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | butyl 5-acetyloxy-6-bromo-2-(carbamimidoylsulfanylmethyl)-1-phenylindole-3-carboxylate |
| SMILES | [H]/N=C(\N)SCc1c(C(=O)OCCCC)c2cc(OC(C)=O)c(Br)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C23H24BrN3O4S/c1-3-4-10-30-22(29)21-16-11-20(31-14(2)28)17(24)12-18(16)27(15-8-6-5-7-9-15)19(21)13-32-23(25)26/h5-9,11-12H,3-4,10,13H2,1-2H3,(H3,25,26) |
| InChIKey | AYNYHOGIUWDHLT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|