C18H17ClF4N2O5S — CID 28556342
2-[2-chloro-4-(2-methoxyethylsulfamoyl)phenoxy]-N-[4-fluoro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 28556342) has the molecular formula C18H17ClF4N2O5S and a molecular weight of 484.86 g/mol. Its IUPAC name is 2-[2-chloro-4-(2-methoxyethylsulfamoyl)phenoxy]-N-[4-fluoro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-chloro-4-(2-methoxyethylsulfamoyl)phenoxy]-N-[4-fluoro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 28556342 |
| Molecular Formula | C18H17ClF4N2O5S |
| Molecular Weight | 484.86 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 2-[2-chloro-4-(2-methoxyethylsulfamoyl)phenoxy]-N-[4-fluoro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCCNS(=O)(=O)c1ccc(OCC(=O)Nc2ccc(F)c(C(F)(F)F)c2)c(Cl)c1 |
| InChI | InChI=1S/C18H17ClF4N2O5S/c1-29-7-6-24-31(27,28)12-3-5-16(14(19)9-12)30-10-17(26)25-11-2-4-15(20)13(8-11)18(21,22)23/h2-5,8-9,24H,6-7,10H2,1H3,(H,25,26) |
| InChIKey | XDARUTFETRMLPK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|