C20H28N2O3S — CID 29063809
N-(benzylcarbamothioyl)-2-[(3R,5R)-5-hexyl-2-oxooxolan-3-yl]acetamide (PubChem CID 29063809) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is N-(benzylcarbamothioyl)-2-[(3R,5R)-5-hexyl-2-oxooxolan-3-yl]acetamide.
| Compound Name | N-(benzylcarbamothioyl)-2-[(3R,5R)-5-hexyl-2-oxooxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 29063809 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-(benzylcarbamothioyl)-2-[(3R,5R)-5-hexyl-2-oxooxolan-3-yl]acetamide |
| SMILES | CCCCCC[C@@H]1C[C@H](CC(=O)NC(=S)NCc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C20H28N2O3S/c1-2-3-4-8-11-17-12-16(19(24)25-17)13-18(23)22-20(26)21-14-15-9-6-5-7-10-15/h5-7,9-10,16-17H,2-4,8,11-14H2,1H3,(H2,21,22,23,26)/t16-,17-/m1/s1 |
| InChIKey | OJHCBGCLUGRTGE-IAGOWNOFSA-N |
| XLogP | 3.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|