C17H30N8O — CID 2909387
2-[[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-diethylpropanamide (PubChem CID 2909387) has the molecular formula C17H30N8O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-[[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-diethylpropanamide.
| Compound Name | 2-[[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 2909387 |
| Molecular Formula | C17H30N8O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-[[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)N(C#N)c1nc(NC(C)C)nc(NC(C)C)n1 |
| InChI | InChI=1S/C17H30N8O/c1-8-24(9-2)14(26)13(7)25(10-18)17-22-15(19-11(3)4)21-16(23-17)20-12(5)6/h11-13H,8-9H2,1-7H3,(H2,19,20,21,22,23) |
| InChIKey | SDTZSAWENVEQNC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|