C16H28N8O — CID 4518737
2-[cyano-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]-N,N-diethylpropanamide (PubChem CID 4518737) has the molecular formula C16H28N8O and a molecular weight of 348.46 g/mol. Its IUPAC name is 2-[cyano-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]-N,N-diethylpropanamide.
| Compound Name | 2-[cyano-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 4518737 |
| Molecular Formula | C16H28N8O |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 2-[cyano-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]-N,N-diethylpropanamide |
| SMILES | CCNc1nc(NC(C)C)nc(N(C#N)C(C)C(=O)N(CC)CC)n1 |
| InChI | InChI=1S/C16H28N8O/c1-7-18-14-20-15(19-11(4)5)22-16(21-14)24(10-17)12(6)13(25)23(8-2)9-3/h11-12H,7-9H2,1-6H3,(H2,18,19,20,21,22) |
| InChIKey | KDWZBKGGJBBLKO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|