C23H18N2O3 — CID 29102761
(2S)-1'-ethyl-3-phenylspiro[1,3-benzoxazine-2,3'-indole]-2',4-dione (PubChem CID 29102761) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is (2S)-1'-ethyl-3-phenylspiro[1,3-benzoxazine-2,3'-indole]-2',4-dione.
| Compound Name | (2S)-1'-ethyl-3-phenylspiro[1,3-benzoxazine-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 29102761 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | (2S)-1'-ethyl-3-phenylspiro[1,3-benzoxazine-2,3'-indole]-2',4-dione |
| SMILES | CCN1C(=O)[C@@]2(Oc3ccccc3C(=O)N2c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H18N2O3/c1-2-24-19-14-8-7-13-18(19)23(22(24)27)25(16-10-4-3-5-11-16)21(26)17-12-6-9-15-20(17)28-23/h3-15H,2H2,1H3/t23-/m0/s1 |
| InChIKey | FWUIZJBSJPGFOG-QHCPKHFHSA-N |
| XLogP | 3.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |