C12H6N6O4 — CID 2911865
7-(2-nitrophenyl)-6-oxidotriazolo[4,5-g][2,1,3]benzoxadiazol-6-ium (PubChem CID 2911865) has the molecular formula C12H6N6O4 and a molecular weight of 298.22 g/mol. Its IUPAC name is 7-(2-nitrophenyl)-6-oxidotriazolo[4,5-g][2,1,3]benzoxadiazol-6-ium.
| Compound Name | 7-(2-nitrophenyl)-6-oxidotriazolo[4,5-g][2,1,3]benzoxadiazol-6-ium |
|---|---|
| PubChem CID | 2911865 |
| Molecular Formula | C12H6N6O4 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 7-(2-nitrophenyl)-6-oxidotriazolo[4,5-g][2,1,3]benzoxadiazol-6-ium |
| SMILES | O=[N+]([O-])c1ccccc1-n1nc2c3nonc3ccc2[n+]1[O-] |
| InChI | InChI=1S/C12H6N6O4/c19-17-10-6-5-7-11(15-22-14-7)12(10)13-16(17)8-3-1-2-4-9(8)18(20)21/h1-6H |
| InChIKey | UAEZCEVKQDRAJN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 126.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|