C7H2N4O4 — CID 169355483
4-isocyanato-5-nitro-2,1,3-benzoxadiazole (PubChem CID 169355483) has the molecular formula C7H2N4O4 and a molecular weight of 206.12 g/mol. Its IUPAC name is 4-isocyanato-5-nitro-2,1,3-benzoxadiazole.
| Compound Name | 4-isocyanato-5-nitro-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 169355483 |
| Molecular Formula | C7H2N4O4 |
| Molecular Weight | 206.12 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 4-isocyanato-5-nitro-2,1,3-benzoxadiazole |
| SMILES | O=C=Nc1c([N+](=O)[O-])ccc2nonc12 |
| InChI | InChI=1S/C7H2N4O4/c12-3-8-7-5(11(13)14)2-1-4-6(7)10-15-9-4/h1-2H |
| InChIKey | PGHNEFJLDIIKHB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 111.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.12 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|