C23H23N3O5S — CID 29128638
N-[(3S)-1,1-dioxothiolan-3-yl]-4-(2-methyl-4-oxo-6-prop-2-enoxyquinazolin-3-yl)benzamide (PubChem CID 29128638) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-4-(2-methyl-4-oxo-6-prop-2-enoxyquinazolin-3-yl)benzamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-(2-methyl-4-oxo-6-prop-2-enoxyquinazolin-3-yl)benzamide |
|---|---|
| PubChem CID | 29128638 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-4-(2-methyl-4-oxo-6-prop-2-enoxyquinazolin-3-yl)benzamide |
| SMILES | C=CCOc1ccc2nc(C)n(-c3ccc(C(=O)N[C@H]4CCS(=O)(=O)C4)cc3)c(=O)c2c1 |
| InChI | InChI=1S/C23H23N3O5S/c1-3-11-31-19-8-9-21-20(13-19)23(28)26(15(2)24-21)18-6-4-16(5-7-18)22(27)25-17-10-12-32(29,30)14-17/h3-9,13,17H,1,10-12,14H2,2H3,(H,25,27)/t17-/m0/s1 |
| InChIKey | ODFXFOSZGNTLDL-KRWDZBQOSA-N |
| XLogP | 2.18 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|