C13H15ClN2O4S — CID 94824234
3-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-6-prop-2-enoxypyridine-2-carboxamide (PubChem CID 94824234) has the molecular formula C13H15ClN2O4S and a molecular weight of 330.79 g/mol. Its IUPAC name is 3-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-6-prop-2-enoxypyridine-2-carboxamide.
| Compound Name | 3-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-6-prop-2-enoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 94824234 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 3-chloro-N-[(3R)-1,1-dioxothiolan-3-yl]-6-prop-2-enoxypyridine-2-carboxamide |
| SMILES | C=CCOc1ccc(Cl)c(C(=O)N[C@@H]2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C13H15ClN2O4S/c1-2-6-20-11-4-3-10(14)12(16-11)13(17)15-9-5-7-21(18,19)8-9/h2-4,9H,1,5-8H2,(H,15,17)/t9-/m1/s1 |
| InChIKey | ZKLCNTHWGCIRQD-SECBINFHSA-N |
| XLogP | 1.22 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|