C17H18N2O4S — CID 2916601
1-(2,4-dimethyl-5-nitrophenyl)sulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 2916601) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-(2,4-dimethyl-5-nitrophenyl)sulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(2,4-dimethyl-5-nitrophenyl)sulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 2916601 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-(2,4-dimethyl-5-nitrophenyl)sulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCCc3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18N2O4S/c1-12-10-13(2)17(11-16(12)19(20)21)24(22,23)18-9-5-7-14-6-3-4-8-15(14)18/h3-4,6,8,10-11H,5,7,9H2,1-2H3 |
| InChIKey | DDEVAHAQQVSDGZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|