C13H12N2O4S2 — CID 23119920
1-(3-nitrothiophen-2-yl)sulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 23119920) has the molecular formula C13H12N2O4S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-(3-nitrothiophen-2-yl)sulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(3-nitrothiophen-2-yl)sulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 23119920 |
| Molecular Formula | C13H12N2O4S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 1-(3-nitrothiophen-2-yl)sulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | O=[N+]([O-])c1ccsc1S(=O)(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C13H12N2O4S2/c16-15(17)12-7-9-20-13(12)21(18,19)14-8-3-5-10-4-1-2-6-11(10)14/h1-2,4,6-7,9H,3,5,8H2 |
| InChIKey | DOQPEJHPQGQUKU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|