C15H13N3O4S2 — CID 58794332
1-(5-isocyano-4-nitrothiophen-2-yl)sulfonyl-2,3,4,5-tetrahydro-1-benzazepine (PubChem CID 58794332) has the molecular formula C15H13N3O4S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 1-(5-isocyano-4-nitrothiophen-2-yl)sulfonyl-2,3,4,5-tetrahydro-1-benzazepine.
| Compound Name | 1-(5-isocyano-4-nitrothiophen-2-yl)sulfonyl-2,3,4,5-tetrahydro-1-benzazepine |
|---|---|
| PubChem CID | 58794332 |
| Molecular Formula | C15H13N3O4S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 1-(5-isocyano-4-nitrothiophen-2-yl)sulfonyl-2,3,4,5-tetrahydro-1-benzazepine |
| SMILES | [C-]#[N+]c1sc(S(=O)(=O)N2CCCCc3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N3O4S2/c1-16-15-13(18(19)20)10-14(23-15)24(21,22)17-9-5-4-7-11-6-2-3-8-12(11)17/h2-3,6,8,10H,4-5,7,9H2 |
| InChIKey | FZMKCXUMZHGPED-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 84.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|