C12H14N4OS — CID 2938182
2-[5-[(4-methylphenyl)methyl]-4-oxo-1,3-thiazol-2-yl]guanidine (PubChem CID 2938182) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 2-[5-[(4-methylphenyl)methyl]-4-oxo-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[5-[(4-methylphenyl)methyl]-4-oxo-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 2938182 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-[5-[(4-methylphenyl)methyl]-4-oxo-1,3-thiazol-2-yl]guanidine |
| SMILES | Cc1ccc(CC2SC(N=C(N)N)=NC2=O)cc1 |
| InChI | InChI=1S/C12H14N4OS/c1-7-2-4-8(5-3-7)6-9-10(17)15-12(18-9)16-11(13)14/h2-5,9H,6H2,1H3,(H4,13,14,15,16,17) |
| InChIKey | NNOYQGOHZDCZFF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|