C18H19F2N3O5S2 — CID 29438376
ethyl 2-[[5-[[(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 29438376) has the molecular formula C18H19F2N3O5S2 and a molecular weight of 459.50 g/mol. Its IUPAC name is ethyl 2-[[5-[[(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 29438376 |
| Molecular Formula | C18H19F2N3O5S2 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | ethyl 2-[[5-[[(E)-3-[4-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)/C=C/c2ccc(OC(F)F)c(OCC)c2)s1 |
| InChI | InChI=1S/C18H19F2N3O5S2/c1-3-26-13-9-11(5-7-12(13)28-16(19)20)6-8-14(24)21-17-22-23-18(30-17)29-10-15(25)27-4-2/h5-9,16H,3-4,10H2,1-2H3,(H,21,22,24)/b8-6+ |
| InChIKey | HKTVMTVEVHOSQV-SOFGYWHQSA-N |
| XLogP | 3.85 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|