C17H15F4N3O5S2 — CID 46806970
ethyl 2-[[5-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 46806970) has the molecular formula C17H15F4N3O5S2 and a molecular weight of 481.45 g/mol. Its IUPAC name is ethyl 2-[[5-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 46806970 |
| Molecular Formula | C17H15F4N3O5S2 |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | ethyl 2-[[5-[[(E)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-enoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(NC(=O)/C=C/c2ccc(OC(F)F)cc2OC(F)F)s1 |
| InChI | InChI=1S/C17H15F4N3O5S2/c1-2-27-13(26)8-30-17-24-23-16(31-17)22-12(25)6-4-9-3-5-10(28-14(18)19)7-11(9)29-15(20)21/h3-7,14-15H,2,8H2,1H3,(H,22,23,25)/b6-4+ |
| InChIKey | OKGYFAXMTUATHG-GQCTYLIASA-N |
| XLogP | 4.05 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|