C25H26N2O7S — CID 29486238
diethyl 3-methyl-5-[[2-(3-quinolin-2-ylpropanoyloxy)acetyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 29486238) has the molecular formula C25H26N2O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is diethyl 3-methyl-5-[[2-(3-quinolin-2-ylpropanoyloxy)acetyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[[2-(3-quinolin-2-ylpropanoyloxy)acetyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 29486238 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | diethyl 3-methyl-5-[[2-(3-quinolin-2-ylpropanoyloxy)acetyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)CCc2ccc3ccccc3n2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C25H26N2O7S/c1-4-32-24(30)21-15(3)22(25(31)33-5-2)35-23(21)27-19(28)14-34-20(29)13-12-17-11-10-16-8-6-7-9-18(16)26-17/h6-11H,4-5,12-14H2,1-3H3,(H,27,28) |
| InChIKey | MVCQDQFAUBKKJA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|