C10H7FN4O3 — CID 2951755
[[amino(1,2,4-oxadiazol-3-yl)methylidene]amino] 2-fluorobenzoate (PubChem CID 2951755) has the molecular formula C10H7FN4O3 and a molecular weight of 250.19 g/mol. Its IUPAC name is [[amino(1,2,4-oxadiazol-3-yl)methylidene]amino] 2-fluorobenzoate.
| Compound Name | [[amino(1,2,4-oxadiazol-3-yl)methylidene]amino] 2-fluorobenzoate |
|---|---|
| PubChem CID | 2951755 |
| Molecular Formula | C10H7FN4O3 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | [[amino(1,2,4-oxadiazol-3-yl)methylidene]amino] 2-fluorobenzoate |
| SMILES | NC(=NOC(=O)c1ccccc1F)c1ncon1 |
| InChI | InChI=1S/C10H7FN4O3/c11-7-4-2-1-3-6(7)10(16)18-14-8(12)9-13-5-17-15-9/h1-5H,(H2,12,14) |
| InChIKey | PRNAVHQJJJVPGP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|