C13H8FN3O2S — CID 4730577
[[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] 2-fluorobenzoate (PubChem CID 4730577) has the molecular formula C13H8FN3O2S and a molecular weight of 289.29 g/mol. Its IUPAC name is [[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] 2-fluorobenzoate.
| Compound Name | [[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] 2-fluorobenzoate |
|---|---|
| PubChem CID | 4730577 |
| Molecular Formula | C13H8FN3O2S |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | [[cyano-(4-methyl-1,3-thiazol-2-yl)methylidene]amino] 2-fluorobenzoate |
| SMILES | Cc1csc(C(C#N)=NOC(=O)c2ccccc2F)n1 |
| InChI | InChI=1S/C13H8FN3O2S/c1-8-7-20-12(16-8)11(6-15)17-19-13(18)9-4-2-3-5-10(9)14/h2-5,7H,1H3 |
| InChIKey | SKPNDMFKATZKKB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|