About 3-bromododecanal
3-bromododecanal (PubChem CID 140990352) has the molecular formula C12H23BrO
and a molecular weight of 263.22 g/mol. Its IUPAC name is 3-bromododecanal.
Molecular Properties
| Compound Name | 3-bromododecanal |
| PubChem CID | 140990352 |
| Molecular Formula | C12H23BrO |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 3-bromododecanal |
| SMILES | CCCCCCCCCC(Br)CC=O |
| InChI | InChI=1S/C12H23BrO/c1-2-3-4-5-6-7-8-9-12(13)10-11-14/h11-12H,2-10H2,1H3 |
| InChIKey | BPUWMMTUBRAUCG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromododecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromododecanal?
The IUPAC name of 3-bromododecanal (CID 140990352) is 3-bromododecanal.
What is the SMILES notation for 3-bromododecanal?
The canonical SMILES for 3-bromododecanal is CCCCCCCCCC(Br)CC=O.
What is the InChIKey of 3-bromododecanal?
The InChIKey is BPUWMMTUBRAUCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23BrO/c1-2-3-4-5-6-7-8-9-12(13)10-11-14/h11-12H,2-10H2,1H3.
What are the key properties of 3-bromododecanal?
3-bromododecanal has a molecular weight of 263.22 g/mol, XLogP of 4.48, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromododecanal is sourced from PubChem (CID 140990352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).