About phenylmercury;phenylmercury(1+);sulfanide
phenylmercury;phenylmercury(1+);sulfanide (PubChem CID 30115) has the molecular formula C12H11Hg2S
and a molecular weight of 588.47 g/mol. Its IUPAC name is phenylmercury;phenylmercury(1+);sulfanide.
Molecular Properties
| Compound Name | phenylmercury;phenylmercury(1+);sulfanide |
| PubChem CID | 30115 |
| Molecular Formula | C12H11Hg2S |
| Molecular Weight | 588.47 g/mol |
| Exact Mass | 591.00 |
| IUPAC Name | phenylmercury;phenylmercury(1+);sulfanide |
| SMILES | [Hg+]c1ccccc1.[Hg]c1ccccc1.[SH-] |
| InChI | InChI=1S/2C6H5.2Hg.H2S/c2*1-2-4-6-5-3-1;;;/h2*1-5H;;;1H2/q;;;+1;/p-1 |
| InChIKey | ODLMGKBFVPMGFO-UHFFFAOYSA-M |
| XLogP | 1.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 588.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze phenylmercury;phenylmercury(1+);sulfanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmercury;phenylmercury(1+);sulfanide?
The IUPAC name of phenylmercury;phenylmercury(1+);sulfanide (CID 30115) is phenylmercury;phenylmercury(1+);sulfanide.
What is the SMILES notation for phenylmercury;phenylmercury(1+);sulfanide?
The canonical SMILES for phenylmercury;phenylmercury(1+);sulfanide is [Hg+]c1ccccc1.[Hg]c1ccccc1.[SH-].
What is the InChIKey of phenylmercury;phenylmercury(1+);sulfanide?
The InChIKey is ODLMGKBFVPMGFO-UHFFFAOYSA-M. The full InChI is InChI=1S/2C6H5.2Hg.H2S/c2*1-2-4-6-5-3-1;;;/h2*1-5H;;;1H2/q;;;+1;/p-1.
What are the key properties of phenylmercury;phenylmercury(1+);sulfanide?
phenylmercury;phenylmercury(1+);sulfanide has a molecular weight of 588.47 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmercury;phenylmercury(1+);sulfanide is sourced from PubChem (CID 30115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).