C9H8BrNS — CID 3024539
2-(4-bromophenyl)-4,5-dihydro-1,3-thiazole (PubChem CID 3024539) has the molecular formula C9H8BrNS and a molecular weight of 242.14 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-(4-bromophenyl)-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 3024539 |
| Molecular Formula | C9H8BrNS |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 240.96 |
| IUPAC Name | 2-(4-bromophenyl)-4,5-dihydro-1,3-thiazole |
| SMILES | Brc1ccc(C2=NCCS2)cc1 |
| InChI | InChI=1S/C9H8BrNS/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-4H,5-6H2 |
| InChIKey | GQODWBBIGYWREA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |