C12H18NO2+ — CID 3029148
2,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-2-ium-6,7-diol (PubChem CID 3029148) has the molecular formula C12H18NO2+ and a molecular weight of 208.28 g/mol. Its IUPAC name is 2,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-2-ium-6,7-diol.
| Compound Name | 2,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-2-ium-6,7-diol |
|---|---|
| PubChem CID | 3029148 |
| Molecular Formula | C12H18NO2+ |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2,2,3-trimethyl-3,4-dihydro-1H-isoquinolin-2-ium-6,7-diol |
| SMILES | CC1Cc2cc(O)c(O)cc2C[N+]1(C)C |
| InChI | InChI=1S/C12H17NO2/c1-8-4-9-5-11(14)12(15)6-10(9)7-13(8,2)3/h5-6,8H,4,7H2,1-3H3,(H-,14,15)/p+1 |
| InChIKey | AYFZKGITGOKQKT-UHFFFAOYSA-O |
| XLogP | 1.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|