C14H22NO2+ — CID 15489411
(1R,3R)-6-methoxy-1,2,2,3-tetramethyl-3,4-dihydro-1H-isoquinolin-2-ium-8-ol (PubChem CID 15489411) has the molecular formula C14H22NO2+ and a molecular weight of 236.33 g/mol. Its IUPAC name is (1R,3R)-6-methoxy-1,2,2,3-tetramethyl-3,4-dihydro-1H-isoquinolin-2-ium-8-ol.
| Compound Name | (1R,3R)-6-methoxy-1,2,2,3-tetramethyl-3,4-dihydro-1H-isoquinolin-2-ium-8-ol |
|---|---|
| PubChem CID | 15489411 |
| Molecular Formula | C14H22NO2+ |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (1R,3R)-6-methoxy-1,2,2,3-tetramethyl-3,4-dihydro-1H-isoquinolin-2-ium-8-ol |
| SMILES | COc1cc(O)c2c(c1)C[C@@H](C)[N+](C)(C)[C@@H]2C |
| InChI | InChI=1S/C14H21NO2/c1-9-6-11-7-12(17-5)8-13(16)14(11)10(2)15(9,3)4/h7-10H,6H2,1-5H3/p+1/t9-,10-/m1/s1 |
| InChIKey | AZAIYNWEFAQYGL-NXEZZACHSA-O |
| XLogP | 2.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|