C18H13F2N3O4S — CID 30291578
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide (PubChem CID 30291578) has the molecular formula C18H13F2N3O4S and a molecular weight of 405.38 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 30291578 |
| Molecular Formula | C18H13F2N3O4S |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide |
| SMILES | O=C(CCn1c(=S)[nH]c2ccccc2c1=O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C18H13F2N3O4S/c19-18(20)26-13-6-5-10(9-14(13)27-18)21-15(24)7-8-23-16(25)11-3-1-2-4-12(11)22-17(23)28/h1-6,9H,7-8H2,(H,21,24)(H,22,28) |
| InChIKey | LAONDXSTAOCGFU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|