C16H11ClN4OS2 — CID 3038332
1-(2-chlorophenyl)-3-(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-yl)thiourea (PubChem CID 3038332) has the molecular formula C16H11ClN4OS2 and a molecular weight of 374.88 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-yl)thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-yl)thiourea |
|---|---|
| PubChem CID | 3038332 |
| Molecular Formula | C16H11ClN4OS2 |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(1-oxo-[1,3]thiazolo[3,2-a]benzimidazol-2-yl)thiourea |
| SMILES | O=C1C(NC(=S)Nc2ccccc2Cl)Sc2nc3ccccc3n21 |
| InChI | InChI=1S/C16H11ClN4OS2/c17-9-5-1-2-6-10(9)18-15(23)20-13-14(22)21-12-8-4-3-7-11(12)19-16(21)24-13/h1-8,13H,(H2,18,20,23) |
| InChIKey | OUJPOGMKHNWUQB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|