C16H17ClN4O3 — CID 3039012
2-[2-(4-chlorophenyl)-6-morpholin-4-ylpyrimidin-4-yl]-N-hydroxyacetamide (PubChem CID 3039012) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-6-morpholin-4-ylpyrimidin-4-yl]-N-hydroxyacetamide.
| Compound Name | 2-[2-(4-chlorophenyl)-6-morpholin-4-ylpyrimidin-4-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 3039012 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-6-morpholin-4-ylpyrimidin-4-yl]-N-hydroxyacetamide |
| SMILES | O=C(Cc1cc(N2CCOCC2)nc(-c2ccc(Cl)cc2)n1)NO |
| InChI | InChI=1S/C16H17ClN4O3/c17-12-3-1-11(2-4-12)16-18-13(10-15(22)20-23)9-14(19-16)21-5-7-24-8-6-21/h1-4,9,23H,5-8,10H2,(H,20,22) |
| InChIKey | VXFRSBRHNBXIFT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|