C19H21ClN2OS2 — CID 3040858
N-(2-butylsulfanylethyl)-2-chlorophenothiazine-10-carboxamide (PubChem CID 3040858) has the molecular formula C19H21ClN2OS2 and a molecular weight of 392.98 g/mol. Its IUPAC name is N-(2-butylsulfanylethyl)-2-chlorophenothiazine-10-carboxamide.
| Compound Name | N-(2-butylsulfanylethyl)-2-chlorophenothiazine-10-carboxamide |
|---|---|
| PubChem CID | 3040858 |
| Molecular Formula | C19H21ClN2OS2 |
| Molecular Weight | 392.98 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | N-(2-butylsulfanylethyl)-2-chlorophenothiazine-10-carboxamide |
| SMILES | CCCCSCCNC(=O)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H21ClN2OS2/c1-2-3-11-24-12-10-21-19(23)22-15-6-4-5-7-17(15)25-18-9-8-14(20)13-16(18)22/h4-9,13H,2-3,10-12H2,1H3,(H,21,23) |
| InChIKey | JFHSXZZGQVJROO-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.98 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|