C15H34N4O7 — CID 3047818
N,N-dimethyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-1-amine;bis(nitric acid) (PubChem CID 3047818) has the molecular formula C15H34N4O7 and a molecular weight of 382.46 g/mol. Its IUPAC name is N,N-dimethyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-1-amine;bis(nitric acid).
| Compound Name | N,N-dimethyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-1-amine;bis(nitric acid) |
|---|---|
| PubChem CID | 3047818 |
| Molecular Formula | C15H34N4O7 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N,N-dimethyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxypropan-1-amine;bis(nitric acid) |
| SMILES | CN(C)CCCOC1CC(C)(C)N(C)C(C)(C)C1.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C15H32N2O.2HNO3/c1-14(2)11-13(12-15(3,4)17(14)7)18-10-8-9-16(5)6;2*2-1(3)4/h13H,8-12H2,1-7H3;2*(H,2,3,4) |
| InChIKey | DXUBYNSHHLYSMX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|