C17H12F3N5O — CID 30806009
(E)-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 30806009) has the molecular formula C17H12F3N5O and a molecular weight of 359.31 g/mol. Its IUPAC name is (E)-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 30806009 |
| Molecular Formula | C17H12F3N5O |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | (E)-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)Nc1ccc(-n2cncn2)nc1 |
| InChI | InChI=1S/C17H12F3N5O/c18-17(19,20)13-4-1-12(2-5-13)3-8-16(26)24-14-6-7-15(22-9-14)25-11-21-10-23-25/h1-11H,(H,24,26)/b8-3+ |
| InChIKey | XZHLMRZPAVLYNR-FPYGCLRLSA-N |
| XLogP | 3.33 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|