About 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate
2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate (PubChem CID 30912081) has the molecular formula C17H17NO5S2
and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate |
| PubChem CID | 30912081 |
| Molecular Formula | C17H17NO5S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(OCCOC(=O)[C@H]2Cc3ccccc3S2)cc1 |
| InChI | InChI=1S/C17H17NO5S2/c18-25(20,21)14-7-5-13(6-8-14)22-9-10-23-17(19)16-11-12-3-1-2-4-15(12)24-16/h1-8,16H,9-11H2,(H2,18,20,21)/t16-/m1/s1 |
| InChIKey | CBVYZPIYIDDRTL-MRXNPFEDSA-N |
| XLogP | 1.97 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate?
The IUPAC name of 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate (CID 30912081) is 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate.
What is the SMILES notation for 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate?
The canonical SMILES for 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate is NS(=O)(=O)c1ccc(OCCOC(=O)[C@H]2Cc3ccccc3S2)cc1.
What is the InChIKey of 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate?
The InChIKey is CBVYZPIYIDDRTL-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H17NO5S2/c18-25(20,21)14-7-5-13(6-8-14)22-9-10-23-17(19)16-11-12-3-1-2-4-15(12)24-16/h1-8,16H,9-11H2,(H2,18,20,21)/t16-/m1/s1.
What are the key properties of 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate?
2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate has a molecular weight of 379.46 g/mol, XLogP of 1.97, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-sulfamoylphenoxy)ethyl (2R)-2,3-dihydro-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 30912081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).