C11H16N6O3 — CID 3094799
2-[cyano-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]ethyl acetate (PubChem CID 3094799) has the molecular formula C11H16N6O3 and a molecular weight of 280.29 g/mol. Its IUPAC name is 2-[cyano-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]ethyl acetate.
| Compound Name | 2-[cyano-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]ethyl acetate |
|---|---|
| PubChem CID | 3094799 |
| Molecular Formula | C11H16N6O3 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-[cyano-[4-(dimethylamino)-6-methoxy-1,3,5-triazin-2-yl]amino]ethyl acetate |
| SMILES | COc1nc(N(C)C)nc(N(C#N)CCOC(C)=O)n1 |
| InChI | InChI=1S/C11H16N6O3/c1-8(18)20-6-5-17(7-12)10-13-9(16(2)3)14-11(15-10)19-4/h5-6H2,1-4H3 |
| InChIKey | WFPUIDCAXCSGNQ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 104.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|