C14H13ClN4O5 — CID 3097032
2-(4-chloro-3,5-dimethylphenoxy)-N-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)imino]acetamide (PubChem CID 3097032) has the molecular formula C14H13ClN4O5 and a molecular weight of 352.73 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)imino]acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)imino]acetamide |
|---|---|
| PubChem CID | 3097032 |
| Molecular Formula | C14H13ClN4O5 |
| Molecular Weight | 352.73 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)imino]acetamide |
| SMILES | Cc1cc(OCC(=O)/N=N/c2c(O)[nH]c(=O)[nH]c2=O)cc(C)c1Cl |
| InChI | InChI=1S/C14H13ClN4O5/c1-6-3-8(4-7(2)10(6)15)24-5-9(20)18-19-11-12(21)16-14(23)17-13(11)22/h3-4H,5H2,1-2H3,(H3,16,17,21,22,23)/b19-18+ |
| InChIKey | RXWISPINUDDJEE-VHEBQXMUSA-N |
| XLogP | 1.73 |
| TPSA | 136.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.73 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|